C17H17F2NO — CID 46591216
N-[1-(2,5-difluorophenyl)ethyl]-3-phenylpropanamide (PubChem CID 46591216) has the molecular formula C17H17F2NO and a molecular weight of 289.32 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-3-phenylpropanamide.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 46591216 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-3-phenylpropanamide |
| SMILES | CC(NC(=O)CCc1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H17F2NO/c1-12(15-11-14(18)8-9-16(15)19)20-17(21)10-7-13-5-3-2-4-6-13/h2-6,8-9,11-12H,7,10H2,1H3,(H,20,21) |
| InChIKey | RBNUJLLYGFEJAL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |