C18H21F2N — CID 43110371
N-[1-(2,5-difluorophenyl)ethyl]-4-phenylbutan-2-amine (PubChem CID 43110371) has the molecular formula C18H21F2N and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-4-phenylbutan-2-amine.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 43110371 |
| Molecular Formula | C18H21F2N |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-4-phenylbutan-2-amine |
| SMILES | CC(CCc1ccccc1)NC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H21F2N/c1-13(8-9-15-6-4-3-5-7-15)21-14(2)17-12-16(19)10-11-18(17)20/h3-7,10-14,21H,8-9H2,1-2H3 |
| InChIKey | MKWVTEDOLFDSHI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |