C13H19F2N — CID 43191491
N-[1-(2,5-difluorophenyl)ethyl]pentan-2-amine (PubChem CID 43191491) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]pentan-2-amine.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]pentan-2-amine |
|---|---|
| PubChem CID | 43191491 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]pentan-2-amine |
| SMILES | CCCC(C)NC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2N/c1-4-5-9(2)16-10(3)12-8-11(14)6-7-13(12)15/h6-10,16H,4-5H2,1-3H3 |
| InChIKey | MBQNIAHTOOFWIK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |