C17H27F2N — CID 43674172
N-[1-(2,5-difluorophenyl)ethyl]-2,6-dimethylheptan-4-amine (PubChem CID 43674172) has the molecular formula C17H27F2N and a molecular weight of 283.41 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-2,6-dimethylheptan-4-amine.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-2,6-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 43674172 |
| Molecular Formula | C17H27F2N |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-2,6-dimethylheptan-4-amine |
| SMILES | CC(C)CC(CC(C)C)NC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H27F2N/c1-11(2)8-15(9-12(3)4)20-13(5)16-10-14(18)6-7-17(16)19/h6-7,10-13,15,20H,8-9H2,1-5H3 |
| InChIKey | UADQKYDUWRMIRF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |