C12H17F2N — CID 43482933
1-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine (PubChem CID 43482933) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine.
| Compound Name | 1-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 43482933 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N,3-dimethylbutan-1-amine |
| SMILES | CNC(CC(C)C)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H17F2N/c1-8(2)6-12(15-3)10-7-9(13)4-5-11(10)14/h4-5,7-8,12,15H,6H2,1-3H3 |
| InChIKey | HHCSGJGAUYXJFO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |