C13H19F2N — CID 63084219
1-(2,4-difluorophenyl)-N,3-dimethylpentan-1-amine (PubChem CID 63084219) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N,3-dimethylpentan-1-amine.
| Compound Name | 1-(2,4-difluorophenyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 63084219 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CC(NC)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H19F2N/c1-4-9(2)7-13(16-3)11-6-5-10(14)8-12(11)15/h5-6,8-9,13,16H,4,7H2,1-3H3 |
| InChIKey | HFFQUQZWAHNXMM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |