C15H24FN — CID 115845233
1-(2-fluoro-4-methylphenyl)-N,3-dimethylhexan-1-amine (PubChem CID 115845233) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-N,3-dimethylhexan-1-amine.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-N,3-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 115845233 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-N,3-dimethylhexan-1-amine |
| SMILES | CCCC(C)CC(NC)c1ccc(C)cc1F |
| InChI | InChI=1S/C15H24FN/c1-5-6-11(2)10-15(17-4)13-8-7-12(3)9-14(13)16/h7-9,11,15,17H,5-6,10H2,1-4H3 |
| InChIKey | OCKAJBKPIMIBHK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |