C12H18F2N2 — CID 116949729
1-(2,4-difluorophenyl)-N,3-dimethylbutane-1,4-diamine (PubChem CID 116949729) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N,3-dimethylbutane-1,4-diamine.
| Compound Name | 1-(2,4-difluorophenyl)-N,3-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949729 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N,3-dimethylbutane-1,4-diamine |
| SMILES | CNC(CC(C)CN)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H18F2N2/c1-8(7-15)5-12(16-2)10-4-3-9(13)6-11(10)14/h3-4,6,8,12,16H,5,7,15H2,1-2H3 |
| InChIKey | PNPZQSUPMRMCRD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |