C11H16F2N2 — CID 116934030
1-(2,4-difluorophenyl)-2-methylbutane-1,4-diamine (PubChem CID 116934030) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-methylbutane-1,4-diamine.
| Compound Name | 1-(2,4-difluorophenyl)-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116934030 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-methylbutane-1,4-diamine |
| SMILES | CC(CCN)C(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H16F2N2/c1-7(4-5-14)11(15)9-3-2-8(12)6-10(9)13/h2-3,6-7,11H,4-5,14-15H2,1H3 |
| InChIKey | RAAKUPOSWRYCNJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |