C8H7F4N — CID 28973274
(1S)-1-(2,4-difluorophenyl)-2,2-difluoroethanamine (PubChem CID 28973274) has the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. Its IUPAC name is (1S)-1-(2,4-difluorophenyl)-2,2-difluoroethanamine.
| Compound Name | (1S)-1-(2,4-difluorophenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 28973274 |
| Molecular Formula | C8H7F4N |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (1S)-1-(2,4-difluorophenyl)-2,2-difluoroethanamine |
| SMILES | N[C@@H](c1ccc(F)cc1F)C(F)F |
| InChI | InChI=1S/C8H7F4N/c9-4-1-2-5(6(10)3-4)7(13)8(11)12/h1-3,7-8H,13H2/t7-/m0/s1 |
| InChIKey | IYNCBVKCAHZJSX-ZETCQYMHSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |