C8H10ClF2NO — CID 67034313
(2R)-2-amino-2-(2,4-difluorophenyl)ethanol;hydrochloride (PubChem CID 67034313) has the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,4-difluorophenyl)ethanol;hydrochloride.
| Compound Name | (2R)-2-amino-2-(2,4-difluorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 67034313 |
| Molecular Formula | C8H10ClF2NO |
| Molecular Weight | 209.62 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | (2R)-2-amino-2-(2,4-difluorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@@H](CO)c1ccc(F)cc1F |
| InChI | InChI=1S/C8H9F2NO.ClH/c9-5-1-2-6(7(10)3-5)8(11)4-12;/h1-3,8,12H,4,11H2;1H/t8-;/m0./s1 |
| InChIKey | OWOSOCQHBOENHK-QRPNPIFTSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.62 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |