C9H13ClFNO — CID 171201973
(2S)-2-amino-2-(2-fluoro-4-methylphenyl)ethanol;hydrochloride (PubChem CID 171201973) has the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-fluoro-4-methylphenyl)ethanol;hydrochloride.
| Compound Name | (2S)-2-amino-2-(2-fluoro-4-methylphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171201973 |
| Molecular Formula | C9H13ClFNO |
| Molecular Weight | 205.66 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2S)-2-amino-2-(2-fluoro-4-methylphenyl)ethanol;hydrochloride |
| SMILES | Cc1ccc([C@H](N)CO)c(F)c1.Cl |
| InChI | InChI=1S/C9H12FNO.ClH/c1-6-2-3-7(8(10)4-6)9(11)5-12;/h2-4,9,12H,5,11H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | MMGUEVIDBPTXJL-SBSPUUFOSA-N |
| XLogP | 1.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.66 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |