C10H15NO — CID 42579716
(2S)-2-amino-2-(2,4-dimethylphenyl)ethanol (PubChem CID 42579716) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,4-dimethylphenyl)ethanol.
| Compound Name | (2S)-2-amino-2-(2,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 42579716 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2S)-2-amino-2-(2,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc([C@H](N)CO)c(C)c1 |
| InChI | InChI=1S/C10H15NO/c1-7-3-4-9(8(2)5-7)10(11)6-12/h3-5,10,12H,6,11H2,1-2H3/t10-/m1/s1 |
| InChIKey | ZTBLTCBXRVNHQW-SNVBAGLBSA-N |
| XLogP | 1.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |