C11H17N — CID 7176017
(1R)-1-(2,4-dimethylphenyl)propan-1-amine (PubChem CID 7176017) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (1R)-1-(2,4-dimethylphenyl)propan-1-amine.
| Compound Name | (1R)-1-(2,4-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 7176017 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (1R)-1-(2,4-dimethylphenyl)propan-1-amine |
| SMILES | CC[C@@H](N)c1ccc(C)cc1C |
| InChI | InChI=1S/C11H17N/c1-4-11(12)10-6-5-8(2)7-9(10)3/h5-7,11H,4,12H2,1-3H3/t11-/m1/s1 |
| InChIKey | CUMKAEFZXDVXGM-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |