C14H23NO — CID 105145254
1-(2,4-dimethylphenyl)-3-propoxypropan-1-amine (PubChem CID 105145254) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-propoxypropan-1-amine.
| Compound Name | 1-(2,4-dimethylphenyl)-3-propoxypropan-1-amine |
|---|---|
| PubChem CID | 105145254 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-propoxypropan-1-amine |
| SMILES | CCCOCCC(N)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H23NO/c1-4-8-16-9-7-14(15)13-6-5-11(2)10-12(13)3/h5-6,10,14H,4,7-9,15H2,1-3H3 |
| InChIKey | JEXRFEGIQNGWBT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|