C9H9F2N — CID 55283550
1-(2,4-difluorophenyl)prop-2-en-1-amine (PubChem CID 55283550) has the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)prop-2-en-1-amine.
| Compound Name | 1-(2,4-difluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 55283550 |
| Molecular Formula | C9H9F2N |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)prop-2-en-1-amine |
| SMILES | C=CC(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F2N/c1-2-9(12)7-4-3-6(10)5-8(7)11/h2-5,9H,1,12H2 |
| InChIKey | GANXWGFGHJXBHO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|