C10H11F2N — CID 95009988
(1S)-1-(2,4-difluorophenyl)but-3-en-1-amine (PubChem CID 95009988) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is (1S)-1-(2,4-difluorophenyl)but-3-en-1-amine.
| Compound Name | (1S)-1-(2,4-difluorophenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 95009988 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (1S)-1-(2,4-difluorophenyl)but-3-en-1-amine |
| SMILES | C=CC[C@H](N)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H11F2N/c1-2-3-10(13)8-5-4-7(11)6-9(8)12/h2,4-6,10H,1,3,13H2/t10-/m0/s1 |
| InChIKey | GAWLFFBCGLMUCI-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|