C10H10F2O — CID 18924035
1-(2,4-difluorophenyl)but-3-en-1-ol (PubChem CID 18924035) has the molecular formula C10H10F2O and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)but-3-en-1-ol.
| Compound Name | 1-(2,4-difluorophenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 18924035 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)but-3-en-1-ol |
| SMILES | C=CCC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H10F2O/c1-2-3-10(13)8-5-4-7(11)6-9(8)12/h2,4-6,10,13H,1,3H2 |
| InChIKey | FDBQWBRRIGOATH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|