C7H6F2O2 — CID 91089962
(2,4-difluorophenyl)methanediol (PubChem CID 91089962) has the molecular formula C7H6F2O2 and a molecular weight of 160.12 g/mol. Its IUPAC name is (2,4-difluorophenyl)methanediol.
| Compound Name | (2,4-difluorophenyl)methanediol |
|---|---|
| PubChem CID | 91089962 |
| Molecular Formula | C7H6F2O2 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | (2,4-difluorophenyl)methanediol |
| SMILES | OC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C7H6F2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,7,10-11H |
| InChIKey | WZKUSZURVJWICK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|