C9H8F2O2 — CID 101087572
(1S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-one (PubChem CID 101087572) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is (1S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-one.
| Compound Name | (1S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 101087572 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (1S)-1-(2,4-difluorophenyl)-1-hydroxypropan-2-one |
| SMILES | CC(=O)[C@@H](O)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H8F2O2/c1-5(12)9(13)7-3-2-6(10)4-8(7)11/h2-4,9,13H,1H3/t9-/m1/s1 |
| InChIKey | CFUOFGCWIVOULI-SECBINFHSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |