C9H7ClF2O — CID 117047610
2-(2,4-difluorophenyl)propanoyl chloride (PubChem CID 117047610) has the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)propanoyl chloride.
| Compound Name | 2-(2,4-difluorophenyl)propanoyl chloride |
|---|---|
| PubChem CID | 117047610 |
| Molecular Formula | C9H7ClF2O |
| Molecular Weight | 204.60 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-(2,4-difluorophenyl)propanoyl chloride |
| SMILES | CC(C(=O)Cl)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H7ClF2O/c1-5(9(10)13)7-3-2-6(11)4-8(7)12/h2-5H,1H3 |
| InChIKey | BKWMZTKKQSHHHO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|