C11H9F6NO — CID 103732061
N-[1-(2,4-difluorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732061) has the molecular formula C11H9F6NO and a molecular weight of 285.19 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732061 |
| Molecular Formula | C11H9F6NO |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(NC(=O)C(F)(F)C(F)F)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H9F6NO/c1-5(7-3-2-6(12)4-8(7)13)18-10(19)11(16,17)9(14)15/h2-5,9H,1H3,(H,18,19) |
| InChIKey | JBZCMYQCGSHQOS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|