C13H14F5NO3 — CID 122146702
2,2,3,3-tetrafluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]propanamide (PubChem CID 122146702) has the molecular formula C13H14F5NO3 and a molecular weight of 327.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 122146702 |
| Molecular Formula | C13H14F5NO3 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1cc(F)c(C(C)NC(=O)C(F)(F)C(F)F)cc1OC |
| InChI | InChI=1S/C13H14F5NO3/c1-6(19-12(20)13(17,18)11(15)16)7-4-9(21-2)10(22-3)5-8(7)14/h4-6,11H,1-3H3,(H,19,20) |
| InChIKey | RVDUPXOWOKKNIM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|