C14H21FN2O3 — CID 119324659
4-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]butanamide (PubChem CID 119324659) has the molecular formula C14H21FN2O3 and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]butanamide.
| Compound Name | 4-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 119324659 |
| Molecular Formula | C14H21FN2O3 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]butanamide |
| SMILES | COc1cc(F)c(C(C)NC(=O)CCCN)cc1OC |
| InChI | InChI=1S/C14H21FN2O3/c1-9(17-14(18)5-4-6-16)10-7-12(19-2)13(20-3)8-11(10)15/h7-9H,4-6,16H2,1-3H3,(H,17,18) |
| InChIKey | RVZQUDTZOQGABR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |