C15H23FN2O3 — CID 119324653
2-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]pentanamide (PubChem CID 119324653) has the molecular formula C15H23FN2O3 and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]pentanamide.
| Compound Name | 2-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 119324653 |
| Molecular Formula | C15H23FN2O3 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-amino-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]pentanamide |
| SMILES | CCCC(N)C(=O)NC(C)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C15H23FN2O3/c1-5-6-12(17)15(19)18-9(2)10-7-13(20-3)14(21-4)8-11(10)16/h7-9,12H,5-6,17H2,1-4H3,(H,18,19) |
| InChIKey | RTDSAAIEAUDTHQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |