C11H14F2 — CID 121459140
2,4-difluoro-1-[(2R)-3-methylbutan-2-yl]benzene (PubChem CID 121459140) has the molecular formula C11H14F2 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2,4-difluoro-1-[(2R)-3-methylbutan-2-yl]benzene.
| Compound Name | 2,4-difluoro-1-[(2R)-3-methylbutan-2-yl]benzene |
|---|---|
| PubChem CID | 121459140 |
| Molecular Formula | C11H14F2 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2,4-difluoro-1-[(2R)-3-methylbutan-2-yl]benzene |
| SMILES | CC(C)[C@@H](C)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H14F2/c1-7(2)8(3)10-5-4-9(12)6-11(10)13/h4-8H,1-3H3/t8-/m1/s1 |
| InChIKey | FSTMIHKXXHQPEG-MRVPVSSYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |