C13H19F2N — CID 79298293
2-(2,4-difluorophenyl)-N,4-dimethylpentan-3-amine (PubChem CID 79298293) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N,4-dimethylpentan-3-amine.
| Compound Name | 2-(2,4-difluorophenyl)-N,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 79298293 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N,4-dimethylpentan-3-amine |
| SMILES | CNC(C(C)C)C(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H19F2N/c1-8(2)13(16-4)9(3)11-6-5-10(14)7-12(11)15/h5-9,13,16H,1-4H3 |
| InChIKey | KFWRQJZHIKAQSL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |