C12H17F2N — CID 89477372
1-(2,4-difluorophenyl)-N,N,2-trimethylpropan-1-amine (PubChem CID 89477372) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N,N,2-trimethylpropan-1-amine.
| Compound Name | 1-(2,4-difluorophenyl)-N,N,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 89477372 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N,N,2-trimethylpropan-1-amine |
| SMILES | CC(C)C(c1ccc(F)cc1F)N(C)C |
| InChI | InChI=1S/C12H17F2N/c1-8(2)12(15(3)4)10-6-5-9(13)7-11(10)14/h5-8,12H,1-4H3 |
| InChIKey | HZYXFDDXIODHOG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |