C9H9F2NO2 — CID 69415011
3-(2,4-difluorophenyl)-3-hydroxypropanamide (PubChem CID 69415011) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-3-hydroxypropanamide.
| Compound Name | 3-(2,4-difluorophenyl)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 69415011 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-(2,4-difluorophenyl)-3-hydroxypropanamide |
| SMILES | NC(=O)CC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F2NO2/c10-5-1-2-6(7(11)3-5)8(13)4-9(12)14/h1-3,8,13H,4H2,(H2,12,14) |
| InChIKey | SPZTWDJRQODBLX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |