C21H22F4N2O4 — CID 166196892
N,N'-bis[2-(2,4-difluorophenyl)-2-hydroxyethyl]pentanediamide (PubChem CID 166196892) has the molecular formula C21H22F4N2O4 and a molecular weight of 442.41 g/mol. Its IUPAC name is N,N'-bis[2-(2,4-difluorophenyl)-2-hydroxyethyl]pentanediamide.
| Compound Name | N,N'-bis[2-(2,4-difluorophenyl)-2-hydroxyethyl]pentanediamide |
|---|---|
| PubChem CID | 166196892 |
| Molecular Formula | C21H22F4N2O4 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N,N'-bis[2-(2,4-difluorophenyl)-2-hydroxyethyl]pentanediamide |
| SMILES | O=C(CCCC(=O)NCC(O)c1ccc(F)cc1F)NCC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H22F4N2O4/c22-12-4-6-14(16(24)8-12)18(28)10-26-20(30)2-1-3-21(31)27-11-19(29)15-7-5-13(23)9-17(15)25/h4-9,18-19,28-29H,1-3,10-11H2,(H,26,30)(H,27,31) |
| InChIKey | GMYWIKZFHZZSHJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |