C9H5F7O — CID 61086809
1-(2,4-difluorophenyl)-2,2,3,3,3-pentafluoropropan-1-ol (PubChem CID 61086809) has the molecular formula C9H5F7O and a molecular weight of 262.12 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2,2,3,3,3-pentafluoropropan-1-ol.
| Compound Name | 1-(2,4-difluorophenyl)-2,2,3,3,3-pentafluoropropan-1-ol |
|---|---|
| PubChem CID | 61086809 |
| Molecular Formula | C9H5F7O |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2,2,3,3,3-pentafluoropropan-1-ol |
| SMILES | OC(c1ccc(F)cc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F7O/c10-4-1-2-5(6(11)3-4)7(17)8(12,13)9(14,15)16/h1-3,7,17H |
| InChIKey | SASTZWUMAVYBGF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|