C8H6F5N — CID 130612107
(1R)-2,2-difluoro-1-(2,3,5-trifluorophenyl)ethanamine (PubChem CID 130612107) has the molecular formula C8H6F5N and a molecular weight of 211.13 g/mol. Its IUPAC name is (1R)-2,2-difluoro-1-(2,3,5-trifluorophenyl)ethanamine.
| Compound Name | (1R)-2,2-difluoro-1-(2,3,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 130612107 |
| Molecular Formula | C8H6F5N |
| Molecular Weight | 211.13 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (1R)-2,2-difluoro-1-(2,3,5-trifluorophenyl)ethanamine |
| SMILES | N[C@H](c1cc(F)cc(F)c1F)C(F)F |
| InChI | InChI=1S/C8H6F5N/c9-3-1-4(7(14)8(12)13)6(11)5(10)2-3/h1-2,7-8H,14H2/t7-/m1/s1 |
| InChIKey | BTTPCBUORMJHIO-SSDOTTSWSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|