C11H15ClF3NO — CID 171268186
(1S,2R)-1-amino-1-(2,3,5-trifluorophenyl)pentan-2-ol;hydrochloride (PubChem CID 171268186) has the molecular formula C11H15ClF3NO and a molecular weight of 269.69 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,3,5-trifluorophenyl)pentan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(2,3,5-trifluorophenyl)pentan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171268186 |
| Molecular Formula | C11H15ClF3NO |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,3,5-trifluorophenyl)pentan-2-ol;hydrochloride |
| SMILES | CCC[C@@H](O)[C@@H](N)c1cc(F)cc(F)c1F.Cl |
| InChI | InChI=1S/C11H14F3NO.ClH/c1-2-3-9(16)11(15)7-4-6(12)5-8(13)10(7)14;/h4-5,9,11,16H,2-3,15H2,1H3;1H/t9-,11+;/m1./s1 |
| InChIKey | QDXLMKQCPBMNRY-XQKZEKTMSA-N |
| XLogP | 2.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|