C13H19ClF3NO — CID 171268190
(1S,2R)-1-amino-5-methyl-1-(2,3,5-trifluorophenyl)hexan-2-ol;hydrochloride (PubChem CID 171268190) has the molecular formula C13H19ClF3NO and a molecular weight of 297.75 g/mol. Its IUPAC name is (1S,2R)-1-amino-5-methyl-1-(2,3,5-trifluorophenyl)hexan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-5-methyl-1-(2,3,5-trifluorophenyl)hexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171268190 |
| Molecular Formula | C13H19ClF3NO |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (1S,2R)-1-amino-5-methyl-1-(2,3,5-trifluorophenyl)hexan-2-ol;hydrochloride |
| SMILES | CC(C)CC[C@@H](O)[C@@H](N)c1cc(F)cc(F)c1F.Cl |
| InChI | InChI=1S/C13H18F3NO.ClH/c1-7(2)3-4-11(18)13(17)9-5-8(14)6-10(15)12(9)16;/h5-7,11,13,18H,3-4,17H2,1-2H3;1H/t11-,13+;/m1./s1 |
| InChIKey | KEBSQSWAZUSJHJ-YLAFAASESA-N |
| XLogP | 3.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|