C11H11F4NO2 — CID 171241412
ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trifluorophenyl)propanoate (PubChem CID 171241412) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trifluorophenyl)propanoate.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 171241412 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(2,3,5-trifluorophenyl)propanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H11F4NO2/c1-2-18-11(17)9(15)10(16)6-3-5(12)4-7(13)8(6)14/h3-4,9-10H,2,16H2,1H3/t9?,10-/m1/s1 |
| InChIKey | SXCUSVPZXYJWMQ-QVDQXJPCSA-N |
| XLogP | 2.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|