C11H11F3O3 — CID 79366836
ethyl 3-(2,5-difluorophenyl)-2-fluoro-3-hydroxypropanoate (PubChem CID 79366836) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is ethyl 3-(2,5-difluorophenyl)-2-fluoro-3-hydroxypropanoate.
| Compound Name | ethyl 3-(2,5-difluorophenyl)-2-fluoro-3-hydroxypropanoate |
|---|---|
| PubChem CID | 79366836 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | ethyl 3-(2,5-difluorophenyl)-2-fluoro-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(F)C(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H11F3O3/c1-2-17-11(16)9(14)10(15)7-5-6(12)3-4-8(7)13/h3-5,9-10,15H,2H2,1H3 |
| InChIKey | CPQVNBNJDJGMHO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |