C12H12F4O4 — CID 79366819
ethyl 2-fluoro-3-hydroxy-3-[2-(trifluoromethoxy)phenyl]propanoate (PubChem CID 79366819) has the molecular formula C12H12F4O4 and a molecular weight of 296.22 g/mol. Its IUPAC name is ethyl 2-fluoro-3-hydroxy-3-[2-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | ethyl 2-fluoro-3-hydroxy-3-[2-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 79366819 |
| Molecular Formula | C12H12F4O4 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | ethyl 2-fluoro-3-hydroxy-3-[2-(trifluoromethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(F)C(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H12F4O4/c1-2-19-11(18)9(13)10(17)7-5-3-4-6-8(7)20-12(14,15)16/h3-6,9-10,17H,2H2,1H3 |
| InChIKey | SGCIVWZATUKMKZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |