C13H15F3O4 — CID 83042460
2-[hydroxy-[2-(trifluoromethoxy)phenyl]methyl]pentanoic acid (PubChem CID 83042460) has the molecular formula C13H15F3O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-[hydroxy-[2-(trifluoromethoxy)phenyl]methyl]pentanoic acid.
| Compound Name | 2-[hydroxy-[2-(trifluoromethoxy)phenyl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 83042460 |
| Molecular Formula | C13H15F3O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[hydroxy-[2-(trifluoromethoxy)phenyl]methyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H15F3O4/c1-2-5-9(12(18)19)11(17)8-6-3-4-7-10(8)20-13(14,15)16/h3-4,6-7,9,11,17H,2,5H2,1H3,(H,18,19) |
| InChIKey | OSTKZSZOEISUQB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |