C13H14F4O3 — CID 83042561
2-[[4-fluoro-2-(trifluoromethyl)phenyl]-hydroxymethyl]pentanoic acid (PubChem CID 83042561) has the molecular formula C13H14F4O3 and a molecular weight of 294.24 g/mol. Its IUPAC name is 2-[[4-fluoro-2-(trifluoromethyl)phenyl]-hydroxymethyl]pentanoic acid.
| Compound Name | 2-[[4-fluoro-2-(trifluoromethyl)phenyl]-hydroxymethyl]pentanoic acid |
|---|---|
| PubChem CID | 83042561 |
| Molecular Formula | C13H14F4O3 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[[4-fluoro-2-(trifluoromethyl)phenyl]-hydroxymethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C(O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14F4O3/c1-2-3-9(12(19)20)11(18)8-5-4-7(14)6-10(8)13(15,16)17/h4-6,9,11,18H,2-3H2,1H3,(H,19,20) |
| InChIKey | LSGSYCACHLNYEU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |