C14H18BrFO3 — CID 114060845
ethyl 2-[(2-bromo-4-fluorophenyl)-hydroxymethyl]pentanoate (PubChem CID 114060845) has the molecular formula C14H18BrFO3 and a molecular weight of 333.20 g/mol. Its IUPAC name is ethyl 2-[(2-bromo-4-fluorophenyl)-hydroxymethyl]pentanoate.
| Compound Name | ethyl 2-[(2-bromo-4-fluorophenyl)-hydroxymethyl]pentanoate |
|---|---|
| PubChem CID | 114060845 |
| Molecular Formula | C14H18BrFO3 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | ethyl 2-[(2-bromo-4-fluorophenyl)-hydroxymethyl]pentanoate |
| SMILES | CCCC(C(=O)OCC)C(O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H18BrFO3/c1-3-5-11(14(18)19-4-2)13(17)10-7-6-9(16)8-12(10)15/h6-8,11,13,17H,3-5H2,1-2H3 |
| InChIKey | RFOYGIGFOQVORO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |