C14H18F2O3 — CID 106532010
ethyl 2-[(3,5-difluorophenyl)-hydroxymethyl]pentanoate (PubChem CID 106532010) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is ethyl 2-[(3,5-difluorophenyl)-hydroxymethyl]pentanoate.
| Compound Name | ethyl 2-[(3,5-difluorophenyl)-hydroxymethyl]pentanoate |
|---|---|
| PubChem CID | 106532010 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | ethyl 2-[(3,5-difluorophenyl)-hydroxymethyl]pentanoate |
| SMILES | CCCC(C(=O)OCC)C(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H18F2O3/c1-3-5-12(14(18)19-4-2)13(17)9-6-10(15)8-11(16)7-9/h6-8,12-13,17H,3-5H2,1-2H3 |
| InChIKey | NMHSFICOVDAKQO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |