C12H16F2O3 — CID 79496044
1-(3,5-difluorophenyl)-2,2-diethoxyethanol (PubChem CID 79496044) has the molecular formula C12H16F2O3 and a molecular weight of 246.25 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2,2-diethoxyethanol.
| Compound Name | 1-(3,5-difluorophenyl)-2,2-diethoxyethanol |
|---|---|
| PubChem CID | 79496044 |
| Molecular Formula | C12H16F2O3 |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2,2-diethoxyethanol |
| SMILES | CCOC(OCC)C(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2O3/c1-3-16-12(17-4-2)11(15)8-5-9(13)7-10(14)6-8/h5-7,11-12,15H,3-4H2,1-2H3 |
| InChIKey | SWVYKGXRTXOUQV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|