C16H22F2O2 — CID 116756591
2-cyclohexyl-1-(3,5-difluorophenyl)-2-ethoxyethanol (PubChem CID 116756591) has the molecular formula C16H22F2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,5-difluorophenyl)-2-ethoxyethanol.
| Compound Name | 2-cyclohexyl-1-(3,5-difluorophenyl)-2-ethoxyethanol |
|---|---|
| PubChem CID | 116756591 |
| Molecular Formula | C16H22F2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-cyclohexyl-1-(3,5-difluorophenyl)-2-ethoxyethanol |
| SMILES | CCOC(C1CCCCC1)C(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H22F2O2/c1-2-20-16(11-6-4-3-5-7-11)15(19)12-8-13(17)10-14(18)9-12/h8-11,15-16,19H,2-7H2,1H3 |
| InChIKey | OFAPCJDJLIWKAF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |