C17H24F2O2 — CID 114931734
1-cyclohexyl-3-(2,6-difluorophenyl)-1-ethoxypropan-2-ol (PubChem CID 114931734) has the molecular formula C17H24F2O2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,6-difluorophenyl)-1-ethoxypropan-2-ol.
| Compound Name | 1-cyclohexyl-3-(2,6-difluorophenyl)-1-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 114931734 |
| Molecular Formula | C17H24F2O2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-cyclohexyl-3-(2,6-difluorophenyl)-1-ethoxypropan-2-ol |
| SMILES | CCOC(C(O)Cc1c(F)cccc1F)C1CCCCC1 |
| InChI | InChI=1S/C17H24F2O2/c1-2-21-17(12-7-4-3-5-8-12)16(20)11-13-14(18)9-6-10-15(13)19/h6,9-10,12,16-17,20H,2-5,7-8,11H2,1H3 |
| InChIKey | UEEKTLUNLGKBGY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |