C10H12F2O2 — CID 103452859
1-(2,6-difluorophenyl)butane-2,3-diol (PubChem CID 103452859) has the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)butane-2,3-diol.
| Compound Name | 1-(2,6-difluorophenyl)butane-2,3-diol |
|---|---|
| PubChem CID | 103452859 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1-(2,6-difluorophenyl)butane-2,3-diol |
| SMILES | CC(O)C(O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2O2/c1-6(13)10(14)5-7-8(11)3-2-4-9(7)12/h2-4,6,10,13-14H,5H2,1H3 |
| InChIKey | MCHUVZXWTQTPQI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |