C12H16F2O — CID 114930978
1-(2,6-difluorophenyl)-2,3-dimethylbutan-2-ol (PubChem CID 114930978) has the molecular formula C12H16F2O and a molecular weight of 214.25 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(2,6-difluorophenyl)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114930978 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H16F2O/c1-8(2)12(3,15)7-9-10(13)5-4-6-11(9)14/h4-6,8,15H,7H2,1-3H3 |
| InChIKey | CGXZCFPAKRNIJE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |