C12H17F2NO — CID 114934759
3-(aminomethyl)-4-(2,6-difluorophenyl)-3-methylbutan-2-ol (PubChem CID 114934759) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 3-(aminomethyl)-4-(2,6-difluorophenyl)-3-methylbutan-2-ol.
| Compound Name | 3-(aminomethyl)-4-(2,6-difluorophenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 114934759 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3-(aminomethyl)-4-(2,6-difluorophenyl)-3-methylbutan-2-ol |
| SMILES | CC(O)C(C)(CN)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H17F2NO/c1-8(16)12(2,7-15)6-9-10(13)4-3-5-11(9)14/h3-5,8,16H,6-7,15H2,1-2H3 |
| InChIKey | RKXCZKISNAKIMM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |