C16H24F2O — CID 114931192
4-[(2,6-difluorophenyl)methyl]-2,6-dimethylheptan-4-ol (PubChem CID 114931192) has the molecular formula C16H24F2O and a molecular weight of 270.36 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methyl]-2,6-dimethylheptan-4-ol.
| Compound Name | 4-[(2,6-difluorophenyl)methyl]-2,6-dimethylheptan-4-ol |
|---|---|
| PubChem CID | 114931192 |
| Molecular Formula | C16H24F2O |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methyl]-2,6-dimethylheptan-4-ol |
| SMILES | CC(C)CC(O)(Cc1c(F)cccc1F)CC(C)C |
| InChI | InChI=1S/C16H24F2O/c1-11(2)8-16(19,9-12(3)4)10-13-14(17)6-5-7-15(13)18/h5-7,11-12,19H,8-10H2,1-4H3 |
| InChIKey | RFYNZIOJQLVZCI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |