About 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol
4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol (PubChem CID 114865108) has the molecular formula C17H27FO
and a molecular weight of 266.40 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol.
Molecular Properties
| Compound Name | 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol |
| PubChem CID | 114865108 |
| Molecular Formula | C17H27FO |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol |
| SMILES | Cc1cc(F)ccc1CC(O)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C17H27FO/c1-12(2)9-17(19,10-13(3)4)11-15-6-7-16(18)8-14(15)5/h6-8,12-13,19H,9-11H2,1-5H3 |
| InChIKey | ZLNKXZKPBRMKKR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol?
The IUPAC name of 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol (CID 114865108) is 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol.
What is the SMILES notation for 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol?
The canonical SMILES for 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol is Cc1cc(F)ccc1CC(O)(CC(C)C)CC(C)C.
What is the InChIKey of 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol?
The InChIKey is ZLNKXZKPBRMKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27FO/c1-12(2)9-17(19,10-13(3)4)11-15-6-7-16(18)8-14(15)5/h6-8,12-13,19H,9-11H2,1-5H3.
What are the key properties of 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol?
4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol has a molecular weight of 266.40 g/mol, XLogP of 4.50, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol is sourced from PubChem (CID 114865108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).