C17H27FO — CID 114865108
4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol (PubChem CID 114865108) has the molecular formula C17H27FO and a molecular weight of 266.40 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol.
| Compound Name | 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol |
|---|---|
| PubChem CID | 114865108 |
| Molecular Formula | C17H27FO |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-[(4-fluoro-2-methylphenyl)methyl]-2,6-dimethylheptan-4-ol |
| SMILES | Cc1cc(F)ccc1CC(O)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C17H27FO/c1-12(2)9-17(19,10-13(3)4)11-15-6-7-16(18)8-14(15)5/h6-8,12-13,19H,9-11H2,1-5H3 |
| InChIKey | ZLNKXZKPBRMKKR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |