C14H20ClF — CID 114349945
1-[2-(chloromethyl)-2,3-dimethylbutyl]-4-fluoro-2-methylbenzene (PubChem CID 114349945) has the molecular formula C14H20ClF and a molecular weight of 242.76 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-2,3-dimethylbutyl]-4-fluoro-2-methylbenzene.
| Compound Name | 1-[2-(chloromethyl)-2,3-dimethylbutyl]-4-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 114349945 |
| Molecular Formula | C14H20ClF |
| Molecular Weight | 242.76 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[2-(chloromethyl)-2,3-dimethylbutyl]-4-fluoro-2-methylbenzene |
| SMILES | Cc1cc(F)ccc1CC(C)(CCl)C(C)C |
| InChI | InChI=1S/C14H20ClF/c1-10(2)14(4,9-15)8-12-5-6-13(16)7-11(12)3/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | KJFODYIFKNEOMP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|